C29H29N3O3S — CID 46936001
benzyl 1,7-dibenzyl-2-oxo-6-sulfanylidene-4,8,9,9a-tetrahydro-3H-pyrimido[1,2-c]pyrimidine-4-carboxylate (PubChem CID 46936001) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is benzyl 1,7-dibenzyl-2-oxo-6-sulfanylidene-4,8,9,9a-tetrahydro-3H-pyrimido[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | benzyl 1,7-dibenzyl-2-oxo-6-sulfanylidene-4,8,9,9a-tetrahydro-3H-pyrimido[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 46936001 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | benzyl 1,7-dibenzyl-2-oxo-6-sulfanylidene-4,8,9,9a-tetrahydro-3H-pyrimido[1,2-c]pyrimidine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CC(=O)N(Cc2ccccc2)C2CCN(Cc3ccccc3)C(=S)N12 |
| InChI | InChI=1S/C29H29N3O3S/c33-27-18-25(28(34)35-21-24-14-8-3-9-15-24)32-26(31(27)20-23-12-6-2-7-13-23)16-17-30(29(32)36)19-22-10-4-1-5-11-22/h1-15,25-26H,16-21H2 |
| InChIKey | KTSAUOSOBWTNBD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|