C27H30BrFN7O4+ — CID 46938082
N-(4-bromo-2-fluorophenyl)-6-methoxy-7-[[1-methyl-1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-4-yl]methoxy]quinazolin-4-amine (PubChem CID 46938082) has the molecular formula C27H30BrFN7O4+ and a molecular weight of 615.48 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-6-methoxy-7-[[1-methyl-1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-4-yl]methoxy]quinazolin-4-amine.
| Compound Name | N-(4-bromo-2-fluorophenyl)-6-methoxy-7-[[1-methyl-1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-4-yl]methoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 46938082 |
| Molecular Formula | C27H30BrFN7O4+ |
| Molecular Weight | 615.48 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-6-methoxy-7-[[1-methyl-1-[(3-methyl-5-nitroimidazol-4-yl)methyl]piperidin-1-ium-4-yl]methoxy]quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1CC[N+](C)(Cc2c([N+](=O)[O-])ncn2C)CC1 |
| InChI | InChI=1S/C27H30BrFN7O4/c1-34-16-32-27(35(37)38)23(34)13-36(2)8-6-17(7-9-36)14-40-25-12-22-19(11-24(25)39-3)26(31-15-30-22)33-21-5-4-18(28)10-20(21)29/h4-5,10-12,15-17H,6-9,13-14H2,1-3H3,(H,30,31,33)/q+1 |
| InChIKey | LPFZVDGNTWZDLO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|