C25H27N3O6S2 — CID 46939467
dimethyl (2R)-2-[[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]anilino]methyl]benzoyl]amino]pentanedioate (PubChem CID 46939467) has the molecular formula C25H27N3O6S2 and a molecular weight of 529.64 g/mol. Its IUPAC name is dimethyl (2R)-2-[[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]anilino]methyl]benzoyl]amino]pentanedioate.
| Compound Name | dimethyl (2R)-2-[[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]anilino]methyl]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 46939467 |
| Molecular Formula | C25H27N3O6S2 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | dimethyl (2R)-2-[[4-[[3-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]anilino]methyl]benzoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@@H](NC(=O)c1ccc(CNc2cccc(CC3SC(=S)NC3=O)c2)cc1)C(=O)OC |
| InChI | InChI=1S/C25H27N3O6S2/c1-33-21(29)11-10-19(24(32)34-2)27-22(30)17-8-6-15(7-9-17)14-26-18-5-3-4-16(12-18)13-20-23(31)28-25(35)36-20/h3-9,12,19-20,26H,10-11,13-14H2,1-2H3,(H,27,30)(H,28,31,35)/t19-,20?/m1/s1 |
| InChIKey | FPJFCTCVGCFDLR-FIWHBWSRSA-N |
| XLogP | 2.58 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|