C32H41NO5 — CID 46941169
N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-(6-methoxynaphthalen-2-yl)-2-oxobutanamide (PubChem CID 46941169) has the molecular formula C32H41NO5 and a molecular weight of 519.68 g/mol. Its IUPAC name is N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-(6-methoxynaphthalen-2-yl)-2-oxobutanamide.
| Compound Name | N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-(6-methoxynaphthalen-2-yl)-2-oxobutanamide |
|---|---|
| PubChem CID | 46941169 |
| Molecular Formula | C32H41NO5 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-(6-methoxynaphthalen-2-yl)-2-oxobutanamide |
| SMILES | COc1ccc2cc(C(C)C(=O)C(=O)NCc3ccc(OCCCCCCC(C)C)c(OC)c3)ccc2c1 |
| InChI | InChI=1S/C32H41NO5/c1-22(2)10-8-6-7-9-17-38-29-16-11-24(18-30(29)37-5)21-33-32(35)31(34)23(3)25-12-13-27-20-28(36-4)15-14-26(27)19-25/h11-16,18-20,22-23H,6-10,17,21H2,1-5H3,(H,33,35) |
| InChIKey | CLTLLNNRERNHOX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|