C31H45NO4 — CID 46941170
N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-[4-(2-methylpropyl)phenyl]-2-oxobutanamide (PubChem CID 46941170) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-[4-(2-methylpropyl)phenyl]-2-oxobutanamide.
| Compound Name | N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-[4-(2-methylpropyl)phenyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 46941170 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | N-[[3-methoxy-4-(7-methyloctoxy)phenyl]methyl]-3-[4-(2-methylpropyl)phenyl]-2-oxobutanamide |
| SMILES | COc1cc(CNC(=O)C(=O)C(C)c2ccc(CC(C)C)cc2)ccc1OCCCCCCC(C)C |
| InChI | InChI=1S/C31H45NO4/c1-22(2)11-9-7-8-10-18-36-28-17-14-26(20-29(28)35-6)21-32-31(34)30(33)24(5)27-15-12-25(13-16-27)19-23(3)4/h12-17,20,22-24H,7-11,18-19,21H2,1-6H3,(H,32,34) |
| InChIKey | VANHLEAUOVIGHI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|