C18H23NO5 — CID 46944455
tert-butyl (3S)-3-[(1S)-2-nitro-1-phenylethyl]-2-oxohex-5-enoate (PubChem CID 46944455) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1S)-2-nitro-1-phenylethyl]-2-oxohex-5-enoate.
| Compound Name | tert-butyl (3S)-3-[(1S)-2-nitro-1-phenylethyl]-2-oxohex-5-enoate |
|---|---|
| PubChem CID | 46944455 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl (3S)-3-[(1S)-2-nitro-1-phenylethyl]-2-oxohex-5-enoate |
| SMILES | C=CC[C@H](C(=O)C(=O)OC(C)(C)C)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H23NO5/c1-5-9-14(16(20)17(21)24-18(2,3)4)15(12-19(22)23)13-10-7-6-8-11-13/h5-8,10-11,14-15H,1,9,12H2,2-4H3/t14-,15+/m0/s1 |
| InChIKey | FPVOPUZHRBJLML-LSDHHAIUSA-N |
| XLogP | 3.15 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|