C17H23N3O — CID 46991605
2-methyl-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 46991605) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-methyl-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 2-methyl-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 46991605 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-methyl-8-(2-phenylpropyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CC1=NC2(CCN(CC(C)c3ccccc3)CC2)C(=O)N1 |
| InChI | InChI=1S/C17H23N3O/c1-13(15-6-4-3-5-7-15)12-20-10-8-17(9-11-20)16(21)18-14(2)19-17/h3-7,13H,8-12H2,1-2H3,(H,18,19,21) |
| InChIKey | SSFMASMFDLGIMP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |