C20H28N4O — CID 155540253
2-benzyl-9-octyl-4,5-dihydro-1H-purin-6-one (PubChem CID 155540253) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-benzyl-9-octyl-4,5-dihydro-1H-purin-6-one.
| Compound Name | 2-benzyl-9-octyl-4,5-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 155540253 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 2-benzyl-9-octyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CCCCCCCCN1C=NC2C(=O)NC(Cc3ccccc3)=NC21 |
| InChI | InChI=1S/C20H28N4O/c1-2-3-4-5-6-10-13-24-15-21-18-19(24)22-17(23-20(18)25)14-16-11-8-7-9-12-16/h7-9,11-12,15,18-19H,2-6,10,13-14H2,1H3,(H,22,23,25) |
| InChIKey | ARZUNTANKQVOPO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|