C16H20N4O — CID 155547380
2-benzyl-9-butyl-4,5-dihydro-1H-purin-6-one (PubChem CID 155547380) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-benzyl-9-butyl-4,5-dihydro-1H-purin-6-one.
| Compound Name | 2-benzyl-9-butyl-4,5-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 155547380 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-benzyl-9-butyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CCCCN1C=NC2C(=O)NC(Cc3ccccc3)=NC21 |
| InChI | InChI=1S/C16H20N4O/c1-2-3-9-20-11-17-14-15(20)18-13(19-16(14)21)10-12-7-5-4-6-8-12/h4-8,11,14-15H,2-3,9-10H2,1H3,(H,18,19,21) |
| InChIKey | URACLVHQWJAWKW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |