C18H24N6O3 — CID 46996851
2-[4-(4-cyclopentyltriazol-1-yl)piperidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide (PubChem CID 46996851) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[4-(4-cyclopentyltriazol-1-yl)piperidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide.
| Compound Name | 2-[4-(4-cyclopentyltriazol-1-yl)piperidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 46996851 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-[4-(4-cyclopentyltriazol-1-yl)piperidin-1-yl]-N-(5-methyl-1,2-oxazol-3-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2CCC(n3cc(C4CCCC4)nn3)CC2)no1 |
| InChI | InChI=1S/C18H24N6O3/c1-12-10-16(21-27-12)19-17(25)18(26)23-8-6-14(7-9-23)24-11-15(20-22-24)13-4-2-3-5-13/h10-11,13-14H,2-9H2,1H3,(H,19,21,25) |
| InChIKey | ZIBGZXIPIVYINI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|