C15H26N4O4 — CID 47029520
ethyl 4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]piperazine-1-carboxylate (PubChem CID 47029520) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is ethyl 4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 47029520 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | ethyl 4-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CCCN2C(=O)NC(C)(C)C2=O)CC1 |
| InChI | InChI=1S/C15H26N4O4/c1-4-23-14(22)18-10-8-17(9-11-18)6-5-7-19-12(20)15(2,3)16-13(19)21/h4-11H2,1-3H3,(H,16,21) |
| InChIKey | PZDNMSHGCLKDDU-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|