C16H19N3O5S2 — CID 47063674
N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 47063674) has the molecular formula C16H19N3O5S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 47063674 |
| Molecular Formula | C16H19N3O5S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[1-[4-(dimethylsulfamoyl)phenyl]ethyl]-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NC(C)c2ccc(S(=O)(=O)N(C)C)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O5S2/c1-10(12-5-7-13(8-6-12)26(23,24)18(3)4)17-16(20)15-9-14(19(21)22)11(2)25-15/h5-10H,1-4H3,(H,17,20) |
| InChIKey | DIDYMADTXMRHPI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|