C18H22N4O4S — CID 47088893
N,N-diethyl-1-[2-(1-methylpyrazol-4-yl)-2-oxoacetyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 47088893) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is N,N-diethyl-1-[2-(1-methylpyrazol-4-yl)-2-oxoacetyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-[2-(1-methylpyrazol-4-yl)-2-oxoacetyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 47088893 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N,N-diethyl-1-[2-(1-methylpyrazol-4-yl)-2-oxoacetyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)C(=O)c1cnn(C)c1 |
| InChI | InChI=1S/C18H22N4O4S/c1-4-21(5-2)27(25,26)15-6-7-16-13(10-15)8-9-22(16)18(24)17(23)14-11-19-20(3)12-14/h6-7,10-12H,4-5,8-9H2,1-3H3 |
| InChIKey | GUAAWKIPDGBDES-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|