C26H30N4O4 — CID 47092004
1-[2-[4-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]ethyl]piperidine-4-carboxamide (PubChem CID 47092004) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[2-[4-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 47092004 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 1-[2-[4-[[(E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoyl]amino]phenyl]ethyl]piperidine-4-carboxamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(CCN3CCC(C(N)=O)CC3)cc2)ccc1OCC#N |
| InChI | InChI=1S/C26H30N4O4/c1-33-24-18-20(4-8-23(24)34-17-13-27)5-9-25(31)29-22-6-2-19(3-7-22)10-14-30-15-11-21(12-16-30)26(28)32/h2-9,18,21H,10-12,14-17H2,1H3,(H2,28,32)(H,29,31)/b9-5+ |
| InChIKey | MHGJDSKBZWXDNY-WEVVVXLNSA-N |
| XLogP | 2.99 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|