C23H21N5O5 — CID 4713335
3,5-dinitro-N-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl)benzamide (PubChem CID 4713335) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is 3,5-dinitro-N-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl)benzamide.
| Compound Name | 3,5-dinitro-N-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl)benzamide |
|---|---|
| PubChem CID | 4713335 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 3,5-dinitro-N-(12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaen-6-yl)benzamide |
| SMILES | CC12CCC(c3nc4cc(NC(=O)c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)ccc4nc31)C2(C)C |
| InChI | InChI=1S/C23H21N5O5/c1-22(2)16-6-7-23(22,3)20-19(16)25-18-10-13(4-5-17(18)26-20)24-21(29)12-8-14(27(30)31)11-15(9-12)28(32)33/h4-5,8-11,16H,6-7H2,1-3H3,(H,24,29) |
| InChIKey | SOEGBHWZPHEQMH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|