C17H18N4O2 — CID 12826441
1,11,11-trimethyl-5-(3-nitrophenyl)-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 12826441) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1,11,11-trimethyl-5-(3-nitrophenyl)-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 1,11,11-trimethyl-5-(3-nitrophenyl)-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 12826441 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1,11,11-trimethyl-5-(3-nitrophenyl)-3,4,6-triazatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CC12CCC(c3nc(-c4cccc([N+](=O)[O-])c4)nnc31)C2(C)C |
| InChI | InChI=1S/C17H18N4O2/c1-16(2)12-7-8-17(16,3)14-13(12)18-15(20-19-14)10-5-4-6-11(9-10)21(22)23/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | YECPBXBGQZPMOQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|