C15H18N4O4S2 — CID 4713584
4-[[2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetyl]amino]butanoic acid (PubChem CID 4713584) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[[2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 4713584 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[[2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetyl]amino]butanoic acid |
| SMILES | C=CCN1C(=O)C(CC(=O)NCCCC(=O)O)SC1=Nc1nccs1 |
| InChI | InChI=1S/C15H18N4O4S2/c1-2-7-19-13(23)10(9-11(20)16-5-3-4-12(21)22)25-15(19)18-14-17-6-8-24-14/h2,6,8,10H,1,3-5,7,9H2,(H,16,20)(H,21,22) |
| InChIKey | IMDWFHLYOSWLJG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|