C18H14ClF3N4O2S2 — CID 3388173
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3388173) has the molecular formula C18H14ClF3N4O2S2 and a molecular weight of 474.92 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3388173 |
| Molecular Formula | C18H14ClF3N4O2S2 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-oxo-3-prop-2-enyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2cc(C(F)(F)F)ccc2Cl)SC1=Nc1nccs1 |
| InChI | InChI=1S/C18H14ClF3N4O2S2/c1-2-6-26-15(28)13(30-17(26)25-16-23-5-7-29-16)9-14(27)24-12-8-10(18(20,21)22)3-4-11(12)19/h2-5,7-8,13H,1,6,9H2,(H,24,27) |
| InChIKey | VEWBQSNQQMGSTJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|