About [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate
[[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate (PubChem CID 4714074) has the molecular formula C18H22BrNO3
and a molecular weight of 380.28 g/mol. Its IUPAC name is [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate |
| PubChem CID | 4714074 |
| Molecular Formula | C18H22BrNO3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)ON=C2CC3CCC2(C)C3(C)CBr)cc1 |
| InChI | InChI=1S/C18H22BrNO3/c1-17-9-8-13(18(17,2)11-19)10-15(17)20-23-16(21)12-4-6-14(22-3)7-5-12/h4-7,13H,8-11H2,1-3H3 |
| InChIKey | FAIYWVBRDLZDKO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate?
The IUPAC name of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate (CID 4714074) is [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate.
What is the SMILES notation for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate?
The canonical SMILES for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate is COc1ccc(C(=O)ON=C2CC3CCC2(C)C3(C)CBr)cc1.
What is the InChIKey of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate?
The InChIKey is FAIYWVBRDLZDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22BrNO3/c1-17-9-8-13(18(17,2)11-19)10-15(17)20-23-16(21)12-4-6-14(22-3)7-5-12/h4-7,13H,8-11H2,1-3H3.
What are the key properties of [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate?
[[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate has a molecular weight of 380.28 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[7-(bromomethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino] 4-methoxybenzoate is sourced from PubChem (CID 4714074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).