C18H17Cl2N5O — CID 4726516
N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine (PubChem CID 4726516) has the molecular formula C18H17Cl2N5O and a molecular weight of 390.27 g/mol. Its IUPAC name is N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine.
| Compound Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
|---|---|
| PubChem CID | 4726516 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-1-prop-2-enyltetrazol-5-amine |
| SMILES | C=CCn1nnnc1NCc1cccc(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5O/c1-2-8-25-18(22-23-24-25)21-11-13-4-3-5-16(9-13)26-12-14-6-7-15(19)10-17(14)20/h2-7,9-10H,1,8,11-12H2,(H,21,22,24) |
| InChIKey | SSRFUGUQCHFVQS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|