C12H16O4S2 — CID 4738539
2-(5-methylthiophen-2-yl)sulfonylcyclohexane-1-carboxylic acid (PubChem CID 4738539) has the molecular formula C12H16O4S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(5-methylthiophen-2-yl)sulfonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-(5-methylthiophen-2-yl)sulfonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 4738539 |
| Molecular Formula | C12H16O4S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2-(5-methylthiophen-2-yl)sulfonylcyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)C2CCCCC2C(=O)O)s1 |
| InChI | InChI=1S/C12H16O4S2/c1-8-6-7-11(17-8)18(15,16)10-5-3-2-4-9(10)12(13)14/h6-7,9-10H,2-5H2,1H3,(H,13,14) |
| InChIKey | ZZVCMJGYJPHEQH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |