C17H12NO4S- — CID 4744093
1,3-benzodioxol-5-yl(naphthalen-2-ylsulfonyl)azanide (PubChem CID 4744093) has the molecular formula C17H12NO4S- and a molecular weight of 326.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(naphthalen-2-ylsulfonyl)azanide.
| Compound Name | 1,3-benzodioxol-5-yl(naphthalen-2-ylsulfonyl)azanide |
|---|---|
| PubChem CID | 4744093 |
| Molecular Formula | C17H12NO4S- |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1,3-benzodioxol-5-yl(naphthalen-2-ylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]c1ccc2c(c1)OCO2)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H12NO4S/c19-23(20,15-7-5-12-3-1-2-4-13(12)9-15)18-14-6-8-16-17(10-14)22-11-21-16/h1-10H,11H2/q-1 |
| InChIKey | APLUXNQLXPUOFE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |