C20H23N4O2+ — CID 4749054
2-amino-6-tert-butyl-4-(4-nitrophenyl)-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile (PubChem CID 4749054) has the molecular formula C20H23N4O2+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-amino-6-tert-butyl-4-(4-nitrophenyl)-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile.
| Compound Name | 2-amino-6-tert-butyl-4-(4-nitrophenyl)-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 4749054 |
| Molecular Formula | C20H23N4O2+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-amino-6-tert-butyl-4-(4-nitrophenyl)-5,6,7,8-tetrahydroquinolin-1-ium-3-carbonitrile |
| SMILES | CC(C)(C)C1CCc2[nH+]c(N)c(C#N)c(-c3ccc([N+](=O)[O-])cc3)c2C1 |
| InChI | InChI=1S/C20H22N4O2/c1-20(2,3)13-6-9-17-15(10-13)18(16(11-21)19(22)23-17)12-4-7-14(8-5-12)24(25)26/h4-5,7-8,13H,6,9-10H2,1-3H3,(H2,22,23)/p+1 |
| InChIKey | GZMBFGVNBVZZGJ-UHFFFAOYSA-O |
| XLogP | 3.68 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|