C16H14N4O3S2 — CID 47495609
2-cyano-3-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 47495609) has the molecular formula C16H14N4O3S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-cyano-3-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 47495609 |
| Molecular Formula | C16H14N4O3S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-cyano-3-(2-cyclopropyl-1,3-thiazol-4-yl)-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1csc(C2CC2)n1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H14N4O3S2/c17-8-11(7-13-9-24-16(20-13)10-1-2-10)15(21)19-12-3-5-14(6-4-12)25(18,22)23/h3-7,9-10H,1-2H2,(H,19,21)(H2,18,22,23) |
| InChIKey | VAYWODNYWFZDNL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|