C17H16N4O4S2 — CID 47818632
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate (PubChem CID 47818632) has the molecular formula C17H16N4O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 47818632 |
| Molecular Formula | C17H16N4O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(dimethylamino)thieno[2,3-d][1,3]thiazole-5-carboxylate |
| SMILES | CN(C)c1nc2sc(C(=O)OCC(=O)NNC(=O)c3ccccc3)cc2s1 |
| InChI | InChI=1S/C17H16N4O4S2/c1-21(2)17-18-15-11(27-17)8-12(26-15)16(24)25-9-13(22)19-20-14(23)10-6-4-3-5-7-10/h3-8H,9H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | DADNTIDFZJHFAP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|