C20H23N3O4 — CID 4784606
1-butyl-5-(5-methylfuran-2-yl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 4784606) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-butyl-5-(5-methylfuran-2-yl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 1-butyl-5-(5-methylfuran-2-yl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 4784606 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-butyl-5-(5-methylfuran-2-yl)-7,8,9,10-tetrahydro-5H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CCCCn1c2c(c(=O)[nH]c1=O)C(c1ccc(C)o1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C20H23N3O4/c1-3-4-10-23-18-17(19(25)22-20(23)26)16(14-9-8-11(2)27-14)15-12(21-18)6-5-7-13(15)24/h8-9,16,21H,3-7,10H2,1-2H3,(H,22,25,26) |
| InChIKey | ODBCVIXLUVZNAN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |