C14H16N4O5S — CID 47855094
3-methylsulfonyl-5-nitro-N-(3-pyrazol-1-ylpropyl)benzamide (PubChem CID 47855094) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is 3-methylsulfonyl-5-nitro-N-(3-pyrazol-1-ylpropyl)benzamide.
| Compound Name | 3-methylsulfonyl-5-nitro-N-(3-pyrazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 47855094 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-methylsulfonyl-5-nitro-N-(3-pyrazol-1-ylpropyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NCCCn2cccn2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H16N4O5S/c1-24(22,23)13-9-11(8-12(10-13)18(20)21)14(19)15-4-2-6-17-7-3-5-16-17/h3,5,7-10H,2,4,6H2,1H3,(H,15,19) |
| InChIKey | VQLBWSWIBDWAOQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|