C24H23N3O4S — CID 4794115
3-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4794115) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4794115 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C24H23N3O4S/c1-26(2)32(30,31)21-15-9-10-18(16-21)17-27-22(28)24(25-23(27)29,19-11-5-3-6-12-19)20-13-7-4-8-14-20/h3-16H,17H2,1-2H3,(H,25,29) |
| InChIKey | ZRRQIZKNTYESSK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|