C26H30N4O9 — CID 4839840
5-(diaminomethylideneamino)-2-[[2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]pentanoic acid (PubChem CID 4839840) has the molecular formula C26H30N4O9 and a molecular weight of 542.55 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 4839840 |
| Molecular Formula | C26H30N4O9 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[[3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl]oxy]acetyl]amino]pentanoic acid |
| SMILES | COc1cc(OC)c(OC)cc1C=C1Oc2cc(OCC(=O)NC(CCCN=C(N)N)C(=O)O)ccc2C1=O |
| InChI | InChI=1S/C26H30N4O9/c1-35-18-12-21(37-3)20(36-2)9-14(18)10-22-24(32)16-7-6-15(11-19(16)39-22)38-13-23(31)30-17(25(33)34)5-4-8-29-26(27)28/h6-7,9-12,17H,4-5,8,13H2,1-3H3,(H,30,31)(H,33,34)(H4,27,28,29) |
| InChIKey | GBTVENDTFDIRGI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 194.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|