C20H14F2N2O7S2 — CID 4840650
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoate (PubChem CID 4840650) has the molecular formula C20H14F2N2O7S2 and a molecular weight of 496.47 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 4840650 |
| Molecular Formula | C20H14F2N2O7S2 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-[2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoate |
| SMILES | O=C(COC(=O)CCN1C(=O)SC(=Cc2cccs2)C1=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C20H14F2N2O7S2/c21-20(22)30-13-4-3-11(8-14(13)31-20)23-16(25)10-29-17(26)5-6-24-18(27)15(33-19(24)28)9-12-2-1-7-32-12/h1-4,7-9H,5-6,10H2,(H,23,25) |
| InChIKey | OCPKFJQGMFWVPP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|