C21H15Cl2N5O4S — CID 4842707
1-[(2,6-dichlorophenyl)methyl]-3-methyl-N'-(4-nitrobenzoyl)thieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 4842707) has the molecular formula C21H15Cl2N5O4S and a molecular weight of 504.36 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-3-methyl-N'-(4-nitrobenzoyl)thieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-3-methyl-N'-(4-nitrobenzoyl)thieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 4842707 |
| Molecular Formula | C21H15Cl2N5O4S |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-3-methyl-N'-(4-nitrobenzoyl)thieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | Cc1nn(Cc2c(Cl)cccc2Cl)c2sc(C(=O)NNC(=O)c3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C21H15Cl2N5O4S/c1-11-14-9-18(20(30)25-24-19(29)12-5-7-13(8-6-12)28(31)32)33-21(14)27(26-11)10-15-16(22)3-2-4-17(15)23/h2-9H,10H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | ISIJUSSIHRCDLA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|