C25H22Cl2N2O6 — CID 4844436
N,N'-bis(5-chloro-2-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanediamide (PubChem CID 4844436) has the molecular formula C25H22Cl2N2O6 and a molecular weight of 517.37 g/mol. Its IUPAC name is N,N'-bis(5-chloro-2-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanediamide.
| Compound Name | N,N'-bis(5-chloro-2-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanediamide |
|---|---|
| PubChem CID | 4844436 |
| Molecular Formula | C25H22Cl2N2O6 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | N,N'-bis(5-chloro-2-methoxyphenyl)-2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanediamide |
| SMILES | COc1cc(C=C(C(=O)Nc2cc(Cl)ccc2OC)C(=O)Nc2cc(Cl)ccc2OC)ccc1O |
| InChI | InChI=1S/C25H22Cl2N2O6/c1-33-21-8-5-15(26)12-18(21)28-24(31)17(10-14-4-7-20(30)23(11-14)35-3)25(32)29-19-13-16(27)6-9-22(19)34-2/h4-13,30H,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | ZXBBQMHIDIOJCW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|