C21H21N3O3S — CID 48532822
4-(2-cyanoethylsulfamoyl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylbenzamide (PubChem CID 48532822) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylbenzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 48532822 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[(4-methylphenyl)methyl]-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(Cc1ccc(C)cc1)C(=O)c1ccc(S(=O)(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-3-15-24(16-18-7-5-17(2)6-8-18)21(25)19-9-11-20(12-10-19)28(26,27)23-14-4-13-22/h1,5-12,23H,4,14-16H2,2H3 |
| InChIKey | BJHBWYZNNRVJQH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|