C16H20N2O4S — CID 4881117
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 4881117) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 4881117 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | O=C(COC(=O)CC1CC2CCC1C2)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H20N2O4S/c19-14(17-18-16(21)13-2-1-5-23-13)9-22-15(20)8-12-7-10-3-4-11(12)6-10/h1-2,5,10-12H,3-4,6-9H2,(H,17,19)(H,18,21) |
| InChIKey | CNKKFISUVMLQTG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|