C12H16N4O4 — CID 4891941
dimethyl 2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]butanedioate (PubChem CID 4891941) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is dimethyl 2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]butanedioate.
| Compound Name | dimethyl 2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]butanedioate |
|---|---|
| PubChem CID | 4891941 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | dimethyl 2-[(4,6-dimethylpyrimidin-2-yl)hydrazinylidene]butanedioate |
| SMILES | COC(=O)CC(=NNc1nc(C)cc(C)n1)C(=O)OC |
| InChI | InChI=1S/C12H16N4O4/c1-7-5-8(2)14-12(13-7)16-15-9(11(18)20-4)6-10(17)19-3/h5H,6H2,1-4H3,(H,13,14,16) |
| InChIKey | AGCSKRGLLDVCEL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|