C17H28N6O5 — CID 48934210
tert-butyl N-[2-[[1-(3-methyl-5-nitroimidazol-4-yl)piperidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 48934210) has the molecular formula C17H28N6O5 and a molecular weight of 396.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-(3-methyl-5-nitroimidazol-4-yl)piperidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[1-(3-methyl-5-nitroimidazol-4-yl)piperidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 48934210 |
| Molecular Formula | C17H28N6O5 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | tert-butyl N-[2-[[1-(3-methyl-5-nitroimidazol-4-yl)piperidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | Cn1cnc([N+](=O)[O-])c1N1CCCC(C(=O)NCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H28N6O5/c1-17(2,3)28-16(25)19-8-7-18-14(24)12-6-5-9-22(10-12)15-13(23(26)27)20-11-21(15)4/h11-12H,5-10H2,1-4H3,(H,18,24)(H,19,25) |
| InChIKey | RYOOWEDUUKYZRA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|