C18H27BrN2O2 — CID 49003014
N-[2-(2-bromophenyl)ethyl]-3-methyl-2-(3-methylbutanoylamino)butanamide (PubChem CID 49003014) has the molecular formula C18H27BrN2O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-[2-(2-bromophenyl)ethyl]-3-methyl-2-(3-methylbutanoylamino)butanamide.
| Compound Name | N-[2-(2-bromophenyl)ethyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
|---|---|
| PubChem CID | 49003014 |
| Molecular Formula | C18H27BrN2O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[2-(2-bromophenyl)ethyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
| SMILES | CC(C)CC(=O)NC(C(=O)NCCc1ccccc1Br)C(C)C |
| InChI | InChI=1S/C18H27BrN2O2/c1-12(2)11-16(22)21-17(13(3)4)18(23)20-10-9-14-7-5-6-8-15(14)19/h5-8,12-13,17H,9-11H2,1-4H3,(H,20,23)(H,21,22) |
| InChIKey | RSPAUUQJZMRQRJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |