C18H27BrN2O4S — CID 166378269
N-[(3-bromo-2-methylphenyl)methylsulfonyl]-3-methyl-2-(3-methylbutanoylamino)butanamide (PubChem CID 166378269) has the molecular formula C18H27BrN2O4S and a molecular weight of 447.40 g/mol. Its IUPAC name is N-[(3-bromo-2-methylphenyl)methylsulfonyl]-3-methyl-2-(3-methylbutanoylamino)butanamide.
| Compound Name | N-[(3-bromo-2-methylphenyl)methylsulfonyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
|---|---|
| PubChem CID | 166378269 |
| Molecular Formula | C18H27BrN2O4S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | N-[(3-bromo-2-methylphenyl)methylsulfonyl]-3-methyl-2-(3-methylbutanoylamino)butanamide |
| SMILES | Cc1c(Br)cccc1CS(=O)(=O)NC(=O)C(NC(=O)CC(C)C)C(C)C |
| InChI | InChI=1S/C18H27BrN2O4S/c1-11(2)9-16(22)20-17(12(3)4)18(23)21-26(24,25)10-14-7-6-8-15(19)13(14)5/h6-8,11-12,17H,9-10H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | UYBMSPGUOJVPOP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |