C16H17N3O3 — CID 49016255
N-(1-cyclopropylethyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide (PubChem CID 49016255) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide.
| Compound Name | N-(1-cyclopropylethyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide |
|---|---|
| PubChem CID | 49016255 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(1-cyclopropylethyl)-3-(3,6-dioxo-1H-pyridazin-2-yl)benzamide |
| SMILES | CC(NC(=O)c1cccc(-n2[nH]c(=O)ccc2=O)c1)C1CC1 |
| InChI | InChI=1S/C16H17N3O3/c1-10(11-5-6-11)17-16(22)12-3-2-4-13(9-12)19-15(21)8-7-14(20)18-19/h2-4,7-11H,5-6H2,1H3,(H,17,22)(H,18,20) |
| InChIKey | SLCKBYFWVXYWQX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |