C15H13F3N4OS — CID 4905045
9-(5-methylthiophen-2-yl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 4905045) has the molecular formula C15H13F3N4OS and a molecular weight of 354.36 g/mol. Its IUPAC name is 9-(5-methylthiophen-2-yl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(5-methylthiophen-2-yl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 4905045 |
| Molecular Formula | C15H13F3N4OS |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 9-(5-methylthiophen-2-yl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc(C2C3=C(CCCC3=O)Nc3nc(C(F)(F)F)nn32)s1 |
| InChI | InChI=1S/C15H13F3N4OS/c1-7-5-6-10(24-7)12-11-8(3-2-4-9(11)23)19-14-20-13(15(16,17)18)21-22(12)14/h5-6,12H,2-4H2,1H3,(H,19,20,21) |
| InChIKey | SWFBGRYAOJXTQR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |