C14H16FN3O3S2 — CID 49355497
3-(dimethylsulfamoyl)-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 49355497) has the molecular formula C14H16FN3O3S2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 49355497 |
| Molecular Formula | C14H16FN3O3S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCCc2nccs2)ccc1F |
| InChI | InChI=1S/C14H16FN3O3S2/c1-18(2)23(20,21)12-9-10(3-4-11(12)15)14(19)17-6-5-13-16-7-8-22-13/h3-4,7-9H,5-6H2,1-2H3,(H,17,19) |
| InChIKey | VUXCVQOHTYNCAA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |