C17H24ClN3O2S — CID 4959098
N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]octanamide (PubChem CID 4959098) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]octanamide.
| Compound Name | N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]octanamide |
|---|---|
| PubChem CID | 4959098 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[[[2-(4-chlorophenyl)acetyl]amino]carbamothioyl]octanamide |
| SMILES | CCCCCCCC(=O)NC(=S)NNC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H24ClN3O2S/c1-2-3-4-5-6-7-15(22)19-17(24)21-20-16(23)12-13-8-10-14(18)11-9-13/h8-11H,2-7,12H2,1H3,(H,20,23)(H2,19,21,22,24) |
| InChIKey | ZYLAYLXBWCRKNX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|