About 2-(Allylthio)aniline
2-(Allylthio)aniline (PubChem CID 4962286) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is 2-prop-2-enylsulfanylaniline.
Molecular Properties
| Compound Name | 2-(Allylthio)aniline |
| PubChem CID | 4962286 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 2-prop-2-enylsulfanylaniline |
| SMILES | C=CCSC1=CC=CC=C1N |
| InChI | InChI=1S/C9H11NS/c1-2-7-11-9-6-4-3-5-8(9)10/h2-6H,1,7,10H2 |
| InChIKey | HDIIJUUMINQFTP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | 125 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(Allylthio)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(Allylthio)aniline?
The IUPAC name of 2-(Allylthio)aniline (CID 4962286) is 2-prop-2-enylsulfanylaniline.
What is the SMILES notation for 2-(Allylthio)aniline?
The canonical SMILES for 2-(Allylthio)aniline is C=CCSC1=CC=CC=C1N.
What is the InChIKey of 2-(Allylthio)aniline?
The InChIKey is HDIIJUUMINQFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-2-7-11-9-6-4-3-5-8(9)10/h2-6H,1,7,10H2.
What are the key properties of 2-(Allylthio)aniline?
2-(Allylthio)aniline has a molecular weight of 165.26 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(Allylthio)aniline is sourced from PubChem (CID 4962286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).