C10H20N4S — CID 4962421
5-(4-ethyl-5-methylsulfanyl-1,2,4-triazol-3-yl)pentan-1-amine (PubChem CID 4962421) has the molecular formula C10H20N4S and a molecular weight of 228.36 g/mol. Its IUPAC name is 5-(4-ethyl-5-methylsulfanyl-1,2,4-triazol-3-yl)pentan-1-amine.
| Compound Name | 5-(4-ethyl-5-methylsulfanyl-1,2,4-triazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 4962421 |
| Molecular Formula | C10H20N4S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 5-(4-ethyl-5-methylsulfanyl-1,2,4-triazol-3-yl)pentan-1-amine |
| SMILES | CCn1c(CCCCCN)nnc1SC |
| InChI | InChI=1S/C10H20N4S/c1-3-14-9(7-5-4-6-8-11)12-13-10(14)15-2/h3-8,11H2,1-2H3 |
| InChIKey | FKKQDRISFZLVNQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|