C22H25BrN4O6S — CID 4966599
N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 4966599) has the molecular formula C22H25BrN4O6S and a molecular weight of 553.44 g/mol. Its IUPAC name is N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 4966599 |
| Molecular Formula | C22H25BrN4O6S |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | N-[5-[(4-bromophenyl)sulfamoyl]-2-methoxyphenyl]-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)Nc2cc(S(=O)(=O)Nc3ccc(Br)cc3)ccc2OC)C1=O |
| InChI | InChI=1S/C22H25BrN4O6S/c1-4-22(5-2)20(29)27(21(30)25-22)13-19(28)24-17-12-16(10-11-18(17)33-3)34(31,32)26-15-8-6-14(23)7-9-15/h6-12,26H,4-5,13H2,1-3H3,(H,24,28)(H,25,30) |
| InChIKey | DFGHSEXLKUZIQY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|