C11H12N4O — CID 4974661
4-ethyl-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4974661) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-ethyl-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-ethyl-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4974661 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 4-ethyl-11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1nc2c3c(C)c(C)oc3ncn2n1 |
| InChI | InChI=1S/C11H12N4O/c1-4-8-13-10-9-6(2)7(3)16-11(9)12-5-15(10)14-8/h5H,4H2,1-3H3 |
| InChIKey | IWBIBLJVLYIFAL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |