C22H29N3O3S — CID 4982290
6-hydroxy-5-[(5-hydroxy-1,3,3-trimethylcyclohexyl)methyliminomethyl]-1-(2-methylphenyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 4982290) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 6-hydroxy-5-[(5-hydroxy-1,3,3-trimethylcyclohexyl)methyliminomethyl]-1-(2-methylphenyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 6-hydroxy-5-[(5-hydroxy-1,3,3-trimethylcyclohexyl)methyliminomethyl]-1-(2-methylphenyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 4982290 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 6-hydroxy-5-[(5-hydroxy-1,3,3-trimethylcyclohexyl)methyliminomethyl]-1-(2-methylphenyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | Cc1ccccc1-n1c(O)c(/C=N/CC2(C)CC(O)CC(C)(C)C2)c(=O)[nH]c1=S |
| InChI | InChI=1S/C22H29N3O3S/c1-14-7-5-6-8-17(14)25-19(28)16(18(27)24-20(25)29)11-23-13-22(4)10-15(26)9-21(2,3)12-22/h5-8,11,15,26,28H,9-10,12-13H2,1-4H3,(H,24,27,29)/b23-11+ |
| InChIKey | MGTQCLXTGITNIG-FOKLQQMPSA-N |
| XLogP | 3.91 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|