C14H13ClN4O5 — CID 4991225
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate (PubChem CID 4991225) has the molecular formula C14H13ClN4O5 and a molecular weight of 352.73 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 4991225 |
| Molecular Formula | C14H13ClN4O5 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 6-oxo-4,5-dihydro-1H-pyridazine-3-carboxylate |
| SMILES | O=C1CCC(C(=O)OCC(=O)NNC(=O)c2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C14H13ClN4O5/c15-9-3-1-8(2-4-9)13(22)19-18-12(21)7-24-14(23)10-5-6-11(20)17-16-10/h1-4H,5-7H2,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | BZEYCVDZINYFGG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|