C24H20Cl2N4O2 — CID 4995070
5-[10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]-2-methoxyphenol (PubChem CID 4995070) has the molecular formula C24H20Cl2N4O2 and a molecular weight of 467.36 g/mol. Its IUPAC name is 5-[10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]-2-methoxyphenol.
| Compound Name | 5-[10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]-2-methoxyphenol |
|---|---|
| PubChem CID | 4995070 |
| Molecular Formula | C24H20Cl2N4O2 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 5-[10,12-dichloro-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc(C2c3c(C)nn(-c4ccc(C)cc4)c3N=C3C(Cl)=CC(Cl)=CN32)cc1O |
| InChI | InChI=1S/C24H20Cl2N4O2/c1-13-4-7-17(8-5-13)30-24-21(14(2)28-30)22(15-6-9-20(32-3)19(31)10-15)29-12-16(25)11-18(26)23(29)27-24/h4-12,22,31H,1-3H3 |
| InChIKey | YZFZXUSAOZDHID-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |