C29H22Cl2N4O — CID 4218651
10,12-dichloro-4-methyl-6-(4-methylphenyl)-2-(3-phenoxyphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 4218651) has the molecular formula C29H22Cl2N4O and a molecular weight of 513.43 g/mol. Its IUPAC name is 10,12-dichloro-4-methyl-6-(4-methylphenyl)-2-(3-phenoxyphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | 10,12-dichloro-4-methyl-6-(4-methylphenyl)-2-(3-phenoxyphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 4218651 |
| Molecular Formula | C29H22Cl2N4O |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 10,12-dichloro-4-methyl-6-(4-methylphenyl)-2-(3-phenoxyphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | Cc1ccc(-n2nc(C)c3c2N=C2C(Cl)=CC(Cl)=CN2C3c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22Cl2N4O/c1-18-11-13-22(14-12-18)35-29-26(19(2)33-35)27(34-17-21(30)16-25(31)28(34)32-29)20-7-6-10-24(15-20)36-23-8-4-3-5-9-23/h3-17,27H,1-2H3 |
| InChIKey | HNKSHFCPTAKBQT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |